About 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide
3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 112658989) has the molecular formula C7H13N5OS
and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 112658989 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CSCCN(C)C(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C7H13N5OS/c1-12(3-4-14-2)6(13)5-9-7(8)11-10-5/h3-4H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | ZEVJHHJNGZHLGZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide (CID 112658989) is 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide is CSCCN(C)C(=O)c1nc(N)n[nH]1.
What is the InChIKey of 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is ZEVJHHJNGZHLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5OS/c1-12(3-4-14-2)6(13)5-9-7(8)11-10-5/h3-4H2,1-2H3,(H3,8,9,10,11).
What are the key properties of 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide?
3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 215.28 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 112658989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).