C6H11N5OS — CID 63960581
3-amino-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 63960581) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-amino-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 63960581 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-amino-N-(2-methylsulfanylethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CSCCNC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C6H11N5OS/c1-13-3-2-8-5(12)4-9-6(7)11-10-4/h2-3H2,1H3,(H,8,12)(H3,7,9,10,11) |
| InChIKey | SWCDKKSAKLQFOH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|