C9H17N5O2 — CID 106161215
3-amino-N-(5-hydroxy-4-methylpentyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 106161215) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-amino-N-(5-hydroxy-4-methylpentyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(5-hydroxy-4-methylpentyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 106161215 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-amino-N-(5-hydroxy-4-methylpentyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(CO)CCCNC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C9H17N5O2/c1-6(5-15)3-2-4-11-8(16)7-12-9(10)14-13-7/h6,15H,2-5H2,1H3,(H,11,16)(H3,10,12,13,14) |
| InChIKey | VVKSIKNWQVUGMY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|