C11H22N6O — CID 62792853
3-amino-N-[4-[methyl(propan-2-yl)amino]butyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62792853) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-amino-N-[4-[methyl(propan-2-yl)amino]butyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-[4-[methyl(propan-2-yl)amino]butyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62792853 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-amino-N-[4-[methyl(propan-2-yl)amino]butyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(C)N(C)CCCCNC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C11H22N6O/c1-8(2)17(3)7-5-4-6-13-10(18)9-14-11(12)16-15-9/h8H,4-7H2,1-3H3,(H,13,18)(H3,12,14,15,16) |
| InChIKey | CIBUCUVISWCDEY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|