About 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide
3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide (PubChem CID 64974852) has the molecular formula C4H7N5O2
and a molecular weight of 157.13 g/mol. Its IUPAC name is 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 64974852 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CONC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C4H7N5O2/c1-11-9-3(10)2-6-4(5)8-7-2/h1H3,(H,9,10)(H3,5,6,7,8) |
| InChIKey | GXDNKASWINEOIP-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide (CID 64974852) is 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide is CONC(=O)c1nc(N)n[nH]1.
What is the InChIKey of 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is GXDNKASWINEOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O2/c1-11-9-3(10)2-6-4(5)8-7-2/h1H3,(H,9,10)(H3,5,6,7,8).
What are the key properties of 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide?
3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 157.13 g/mol, XLogP of -1.32, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-methoxy-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 64974852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).