C8H13N5O — CID 106187377
3-amino-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 106187377) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 3-amino-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 106187377 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3-amino-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(C)=CCNC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C8H13N5O/c1-5(2)3-4-10-7(14)6-11-8(9)13-12-6/h3H,4H2,1-2H3,(H,10,14)(H3,9,11,12,13) |
| InChIKey | KGZRGAXIFCNUDU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|