C11H13N5O — CID 55114994
3-amino-N-benzyl-N-methyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 55114994) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-amino-N-benzyl-N-methyl-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-benzyl-N-methyl-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 55114994 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-amino-N-benzyl-N-methyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C11H13N5O/c1-16(7-8-5-3-2-4-6-8)10(17)9-13-11(12)15-14-9/h2-6H,7H2,1H3,(H3,12,13,14,15) |
| InChIKey | ACJYSYAXCTYDNB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |