C10H13N3OS — CID 59369515
CID 59369515 (PubChem CID 59369515) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol.
| Compound Name | CID 59369515 |
|---|---|
| PubChem CID | 59369515 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | — |
| SMILES | [CH]c1cncc(C(=O)N(C)CCSC)n1 |
| InChI | InChI=1S/C10H13N3OS/c1-8-6-11-7-9(12-8)10(14)13(2)4-5-15-3/h1,6-7H,4-5H2,2-3H3 |
| InChIKey | MFFPCSOTTWBCMU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |