C11H13N3O — CID 59369483
CID 59369483 (PubChem CID 59369483) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol.
| Compound Name | CID 59369483 |
|---|---|
| PubChem CID | 59369483 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | — |
| SMILES | [CH]c1cncc(C(=O)N(C)CC2CC2)n1 |
| InChI | InChI=1S/C11H13N3O/c1-8-5-12-6-10(13-8)11(15)14(2)7-9-3-4-9/h1,5-6,9H,3-4,7H2,2H3 |
| InChIKey | SWJIMCNFASTSHN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |