C7H11BrN4O — CID 80665711
N-(2-bromopropyl)-N-methyl-2H-triazole-4-carboxamide (PubChem CID 80665711) has the molecular formula C7H11BrN4O and a molecular weight of 247.10 g/mol. Its IUPAC name is N-(2-bromopropyl)-N-methyl-2H-triazole-4-carboxamide.
| Compound Name | N-(2-bromopropyl)-N-methyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 80665711 |
| Molecular Formula | C7H11BrN4O |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | N-(2-bromopropyl)-N-methyl-2H-triazole-4-carboxamide |
| SMILES | CC(Br)CN(C)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C7H11BrN4O/c1-5(8)4-12(2)7(13)6-3-9-11-10-6/h3,5H,4H2,1-2H3,(H,9,10,11) |
| InChIKey | IPWOJEVCEGXQMX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|