C18H29BrN2O — CID 132587531
5-bromo-N,N-dihexylpyridine-3-carboxamide (PubChem CID 132587531) has the molecular formula C18H29BrN2O and a molecular weight of 369.35 g/mol. Its IUPAC name is 5-bromo-N,N-dihexylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N,N-dihexylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 132587531 |
| Molecular Formula | C18H29BrN2O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-bromo-N,N-dihexylpyridine-3-carboxamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C18H29BrN2O/c1-3-5-7-9-11-21(12-10-8-6-4-2)18(22)16-13-17(19)15-20-14-16/h13-15H,3-12H2,1-2H3 |
| InChIKey | VICLVNPJBXTFAM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|