C17H25BrFNO — CID 63524944
4-bromo-3-fluoro-N,N-dipentylbenzamide (PubChem CID 63524944) has the molecular formula C17H25BrFNO and a molecular weight of 358.30 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N,N-dipentylbenzamide.
| Compound Name | 4-bromo-3-fluoro-N,N-dipentylbenzamide |
|---|---|
| PubChem CID | 63524944 |
| Molecular Formula | C17H25BrFNO |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-bromo-3-fluoro-N,N-dipentylbenzamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C17H25BrFNO/c1-3-5-7-11-20(12-8-6-4-2)17(21)14-9-10-15(18)16(19)13-14/h9-10,13H,3-8,11-12H2,1-2H3 |
| InChIKey | YIBVVADMTUAWOW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|