C7H9BrF2N4O — CID 107491755
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide (PubChem CID 107491755) has the molecular formula C7H9BrF2N4O and a molecular weight of 283.08 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 107491755 |
| Molecular Formula | C7H9BrF2N4O |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide |
| SMILES | O=C(c1cn[nH]n1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C7H9BrF2N4O/c8-1-2-14(4-6(9)10)7(15)5-3-11-13-12-5/h3,6H,1-2,4H2,(H,11,12,13) |
| InChIKey | NFWNYUGWKQABSO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|