About N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide (PubChem CID 107491755) has the molecular formula C7H9BrF2N4O
and a molecular weight of 283.08 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide |
| PubChem CID | 107491755 |
| Molecular Formula | C7H9BrF2N4O |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide |
| SMILES | O=C(c1cn[nH]n1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C7H9BrF2N4O/c8-1-2-14(4-6(9)10)7(15)5-3-11-13-12-5/h3,6H,1-2,4H2,(H,11,12,13) |
| InChIKey | NFWNYUGWKQABSO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide?
The IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide (CID 107491755) is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide.
What is the SMILES notation for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide?
The canonical SMILES for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide is O=C(c1cn[nH]n1)N(CCBr)CC(F)F.
What is the InChIKey of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide?
The InChIKey is NFWNYUGWKQABSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF2N4O/c8-1-2-14(4-6(9)10)7(15)5-3-11-13-12-5/h3,6H,1-2,4H2,(H,11,12,13).
What are the key properties of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide?
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide has a molecular weight of 283.08 g/mol, XLogP of 0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2H-triazole-4-carboxamide is sourced from PubChem (CID 107491755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).