C11H14BrF2NOS — CID 107491841
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 107491841) has the molecular formula C11H14BrF2NOS and a molecular weight of 326.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107491841 |
| Molecular Formula | C11H14BrF2NOS |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCBr)CC(F)F)sc1C |
| InChI | InChI=1S/C11H14BrF2NOS/c1-7-5-9(17-8(7)2)11(16)15(4-3-12)6-10(13)14/h5,10H,3-4,6H2,1-2H3 |
| InChIKey | YPJRMABYQQJROT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|