C10H12BrF2NO2 — CID 107491884
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methylfuran-3-carboxamide (PubChem CID 107491884) has the molecular formula C10H12BrF2NO2 and a molecular weight of 296.11 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 107491884 |
| Molecular Formula | C10H12BrF2NO2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(CCBr)CC(F)F |
| InChI | InChI=1S/C10H12BrF2NO2/c1-7-8(2-5-16-7)10(15)14(4-3-11)6-9(12)13/h2,5,9H,3-4,6H2,1H3 |
| InChIKey | FWZSSUCCFNNGRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|