C12H8ClN3O4S — CID 88719714
2-(2-amino-1,3-thiazol-4-yl)-2-(4-chlorobenzoyl)oxyiminoacetic acid (PubChem CID 88719714) has the molecular formula C12H8ClN3O4S and a molecular weight of 325.73 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-(4-chlorobenzoyl)oxyiminoacetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(4-chlorobenzoyl)oxyiminoacetic acid |
|---|---|
| PubChem CID | 88719714 |
| Molecular Formula | C12H8ClN3O4S |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(4-chlorobenzoyl)oxyiminoacetic acid |
| SMILES | Nc1nc(C(=NOC(=O)c2ccc(Cl)cc2)C(=O)O)cs1 |
| InChI | InChI=1S/C12H8ClN3O4S/c13-7-3-1-6(2-4-7)11(19)20-16-9(10(17)18)8-5-21-12(14)15-8/h1-5H,(H2,14,15)(H,17,18) |
| InChIKey | QQEGMJWBKNRCDX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|