C16H23N3O7S — CID 139694501
ethyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]-2-[2-(propan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 139694501) has the molecular formula C16H23N3O7S and a molecular weight of 401.44 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]-2-[2-(propan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]-2-[2-(propan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 139694501 |
| Molecular Formula | C16H23N3O7S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]-2-[2-(propan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)C(=NOC(=O)OC(C)(C)C)c1csc(NC(=O)OC(C)C)n1 |
| InChI | InChI=1S/C16H23N3O7S/c1-7-23-12(20)11(19-26-15(22)25-16(4,5)6)10-8-27-13(17-10)18-14(21)24-9(2)3/h8-9H,7H2,1-6H3,(H,17,18,21) |
| InChIKey | QNSFHBXOVXUWOU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|