C18H28N4O6S — CID 139907960
tert-butyl (2S)-2-amino-3-[[4-[(Z)-C-ethoxycarbonyl-N-propan-2-yloxycarbonimidoyl]-1,3-thiazol-2-yl]amino]-2-methyl-3-oxopropanoate (PubChem CID 139907960) has the molecular formula C18H28N4O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-3-[[4-[(Z)-C-ethoxycarbonyl-N-propan-2-yloxycarbonimidoyl]-1,3-thiazol-2-yl]amino]-2-methyl-3-oxopropanoate.
| Compound Name | tert-butyl (2S)-2-amino-3-[[4-[(Z)-C-ethoxycarbonyl-N-propan-2-yloxycarbonimidoyl]-1,3-thiazol-2-yl]amino]-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 139907960 |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl (2S)-2-amino-3-[[4-[(Z)-C-ethoxycarbonyl-N-propan-2-yloxycarbonimidoyl]-1,3-thiazol-2-yl]amino]-2-methyl-3-oxopropanoate |
| SMILES | CCOC(=O)/C(=N\OC(C)C)c1csc(NC(=O)[C@](C)(N)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H28N4O6S/c1-8-26-13(23)12(22-28-10(2)3)11-9-29-16(20-11)21-14(24)18(7,19)15(25)27-17(4,5)6/h9-10H,8,19H2,1-7H3,(H,20,21,24)/b22-12-/t18-/m0/s1 |
| InChIKey | BNDOIQGSPMLEKC-AIRTYWKNSA-N |
| XLogP | 1.83 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|