C10H16N3O6PS — CID 54481551
2-[2-(diethoxyphosphorylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid (PubChem CID 54481551) has the molecular formula C10H16N3O6PS and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-[2-(diethoxyphosphorylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid.
| Compound Name | 2-[2-(diethoxyphosphorylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 54481551 |
| Molecular Formula | C10H16N3O6PS |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[2-(diethoxyphosphorylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
| SMILES | CCOP(=O)(Nc1nc(C(=NOC)C(=O)O)cs1)OCC |
| InChI | InChI=1S/C10H16N3O6PS/c1-4-18-20(16,19-5-2)13-10-11-7(6-21-10)8(9(14)15)12-17-3/h6H,4-5H2,1-3H3,(H,14,15)(H,11,13,16) |
| InChIKey | XPIGXTKWWHNTTH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|