C23H23N3O4S — CID 87453165
(2E)-2-[2-[(2,2-dimethyl-3,3-diphenylpropanoyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid (PubChem CID 87453165) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is (2E)-2-[2-[(2,2-dimethyl-3,3-diphenylpropanoyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid.
| Compound Name | (2E)-2-[2-[(2,2-dimethyl-3,3-diphenylpropanoyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 87453165 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2E)-2-[2-[(2,2-dimethyl-3,3-diphenylpropanoyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(/C(=O)O)c1csc(NC(=O)C(C)(C)C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3O4S/c1-23(2,18(15-10-6-4-7-11-15)16-12-8-5-9-13-16)21(29)25-22-24-17(14-31-22)19(20(27)28)26-30-3/h4-14,18H,1-3H3,(H,27,28)(H,24,25,29)/b26-19+ |
| InChIKey | DTOFXTJYLAIDJI-LGUFXXKBSA-N |
| XLogP | 4.38 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|