C6H6BN3O3S — CID 89378164
CID 89378164 (PubChem CID 89378164) has the molecular formula C6H6BN3O3S and a molecular weight of 211.01 g/mol.
| Compound Name | CID 89378164 |
|---|---|
| PubChem CID | 89378164 |
| Molecular Formula | C6H6BN3O3S |
| Molecular Weight | 211.01 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | — |
| SMILES | [B]NC(C(=O)O)c1csc(NC=O)n1 |
| InChI | InChI=1S/C6H6BN3O3S/c7-10-4(5(12)13)3-1-14-6(9-3)8-2-11/h1-2,4,10H,(H,12,13)(H,8,9,11) |
| InChIKey | OETAXMKGKACKJV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.01 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|