About 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid
2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 139701853) has the molecular formula C8H9N3O5S
and a molecular weight of 259.24 g/mol. Its IUPAC name is 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 139701853 |
| Molecular Formula | C8H9N3O5S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCC(=O)Nc1nc(C(=NO)C(=O)O)cs1 |
| InChI | InChI=1S/C8H9N3O5S/c1-16-2-5(12)10-8-9-4(3-17-8)6(11-15)7(13)14/h3,15H,2H2,1H3,(H,13,14)(H,9,10,12) |
| InChIKey | RSUUDVIUSSTZOQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid (CID 139701853) is 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid is COCC(=O)Nc1nc(C(=NO)C(=O)O)cs1.
What is the InChIKey of 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is RSUUDVIUSSTZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5S/c1-16-2-5(12)10-8-9-4(3-17-8)6(11-15)7(13)14/h3,15H,2H2,1H3,(H,13,14)(H,9,10,12).
What are the key properties of 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 259.24 g/mol, XLogP of -0.01, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 139701853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).