C9H9N3O6S — CID 139707633
2-formyloxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 139707633) has the molecular formula C9H9N3O6S and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-formyloxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-formyloxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 139707633 |
| Molecular Formula | C9H9N3O6S |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-formyloxyimino-2-[2-[(2-methoxyacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCC(=O)Nc1nc(C(=NOC=O)C(=O)O)cs1 |
| InChI | InChI=1S/C9H9N3O6S/c1-17-2-6(14)11-9-10-5(3-19-9)7(8(15)16)12-18-4-13/h3-4H,2H2,1H3,(H,15,16)(H,10,11,14) |
| InChIKey | AILPVKUOZHALEG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|