C18H18N2O6S — CID 131866101
5-ethoxy-5-oxo-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enoic acid (PubChem CID 131866101) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-ethoxy-5-oxo-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enoic acid.
| Compound Name | 5-ethoxy-5-oxo-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enoic acid |
|---|---|
| PubChem CID | 131866101 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-ethoxy-5-oxo-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enoic acid |
| SMILES | CCOC(=O)CC=C(C(=O)O)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N2O6S/c1-2-25-15(21)9-8-13(16(22)23)14-11-27-17(19-14)20-18(24)26-10-12-6-4-3-5-7-12/h3-8,11H,2,9-10H2,1H3,(H,22,23)(H,19,20,24) |
| InChIKey | ZKUVUUYWEGZSFL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|