C14H20N2O6S2 — CID 56610228
ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-3-methylsulfonylprop-2-enoate (PubChem CID 56610228) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-3-methylsulfonylprop-2-enoate.
| Compound Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-3-methylsulfonylprop-2-enoate |
|---|---|
| PubChem CID | 56610228 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-3-methylsulfonylprop-2-enoate |
| SMILES | CCOC(=O)C(=CS(C)(=O)=O)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C14H20N2O6S2/c1-6-21-11(17)9(8-24(5,19)20)10-7-23-12(15-10)16-13(18)22-14(2,3)4/h7-8H,6H2,1-5H3,(H,15,16,18) |
| InChIKey | DEOKRBCLAHUBKB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|