C33H31N5O4S2 — CID 10675432
2-[[2-[6-(tritylamino)hexanoylamino]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 10675432) has the molecular formula C33H31N5O4S2 and a molecular weight of 625.78 g/mol. Its IUPAC name is 2-[[2-[6-(tritylamino)hexanoylamino]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[2-[6-(tritylamino)hexanoylamino]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 10675432 |
| Molecular Formula | C33H31N5O4S2 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 2-[[2-[6-(tritylamino)hexanoylamino]-1,3-thiazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(CCCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)Nc1nc(C(=O)Nc2nc(C(=O)O)cs2)cs1 |
| InChI | InChI=1S/C33H31N5O4S2/c39-28(37-31-35-26(21-43-31)29(40)38-32-36-27(22-44-32)30(41)42)19-11-4-12-20-34-33(23-13-5-1-6-14-23,24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-3,5-10,13-18,21-22,34H,4,11-12,19-20H2,(H,41,42)(H,35,37,39)(H,36,38,40) |
| InChIKey | URXWBAHKGDFPPX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|