C14H13N3O4S — CID 39164379
3-[[2-(propanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoic acid (PubChem CID 39164379) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-[[2-(propanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(propanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 39164379 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-[[2-(propanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoic acid |
| SMILES | CCC(=O)Nc1nc(C(=O)Nc2cccc(C(=O)O)c2)cs1 |
| InChI | InChI=1S/C14H13N3O4S/c1-2-11(18)17-14-16-10(7-22-14)12(19)15-9-5-3-4-8(6-9)13(20)21/h3-7H,2H2,1H3,(H,15,19)(H,20,21)(H,16,17,18) |
| InChIKey | JFPDBDXIALULIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |