C22H21N3O4S — CID 84550864
ethyl 4-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoate (PubChem CID 84550864) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl 4-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 84550864 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethyl 4-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2csc(NC(=O)CCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H21N3O4S/c1-2-29-21(28)16-9-11-17(12-10-16)23-20(27)18-14-30-22(24-18)25-19(26)13-8-15-6-4-3-5-7-15/h3-7,9-12,14H,2,8,13H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | SFQQHDQGDWOBSF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |