C17H19N3O4S — CID 84555961
2-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]butanoic acid (PubChem CID 84555961) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 2-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 84555961 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[[2-(3-phenylpropanoylamino)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)c1csc(NC(=O)CCc2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C17H19N3O4S/c1-2-12(16(23)24)18-15(22)13-10-25-17(19-13)20-14(21)9-8-11-6-4-3-5-7-11/h3-7,10,12H,2,8-9H2,1H3,(H,18,22)(H,23,24)(H,19,20,21) |
| InChIKey | BKJYRDFBHVMESI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |