C23H28N4O2S — CID 18319742
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-methylpropanamide (PubChem CID 18319742) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-methylpropanamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 18319742 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(CCNCC(O)c2ccccc2)cc1)c1csc(N)n1 |
| InChI | InChI=1S/C23H28N4O2S/c1-23(2,20-15-30-22(24)27-20)21(29)26-18-10-8-16(9-11-18)12-13-25-14-19(28)17-6-4-3-5-7-17/h3-11,15,19,25,28H,12-14H2,1-2H3,(H2,24,27)(H,26,29) |
| InChIKey | ZXMFQUQMWSQRPZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|