C22H23N3O2 — CID 139886411
4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]-N-phenylpyridine-2-carboxamide (PubChem CID 139886411) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]-N-phenylpyridine-2-carboxamide.
| Compound Name | 4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 139886411 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]-N-phenylpyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(CCNC[C@H](O)c2ccccc2)ccn1 |
| InChI | InChI=1S/C22H23N3O2/c26-21(18-7-3-1-4-8-18)16-23-13-11-17-12-14-24-20(15-17)22(27)25-19-9-5-2-6-10-19/h1-10,12,14-15,21,23,26H,11,13,16H2,(H,25,27)/t21-/m0/s1 |
| InChIKey | SIXJYELRCJULIF-NRFANRHFSA-N |
| XLogP | 3.20 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|