C23H26ClN3O2 — CID 46192969
N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride (PubChem CID 46192969) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 46192969 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccn1)Nc1ccc(CCNC[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O2.ClH/c27-22(19-6-2-1-3-7-19)17-24-15-13-18-9-11-20(12-10-18)26-23(28)16-21-8-4-5-14-25-21;/h1-12,14,22,24,27H,13,15-17H2,(H,26,28);1H/t22-;/m0./s1 |
| InChIKey | UPBOCHOZAFEMSV-FTBISJDPSA-N |
| XLogP | 3.55 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|