C30H30N4O4 — CID 87212137
N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[3-[(2-phenylphenyl)carbamoylamino]phenyl]ethylamino]ethyl]phenyl]formamide (PubChem CID 87212137) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[3-[(2-phenylphenyl)carbamoylamino]phenyl]ethylamino]ethyl]phenyl]formamide.
| Compound Name | N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[3-[(2-phenylphenyl)carbamoylamino]phenyl]ethylamino]ethyl]phenyl]formamide |
|---|---|
| PubChem CID | 87212137 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[3-[(2-phenylphenyl)carbamoylamino]phenyl]ethylamino]ethyl]phenyl]formamide |
| SMILES | O=CNc1cc([C@H](O)CNCCc2cccc(NC(=O)Nc3ccccc3-c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C30H30N4O4/c35-20-32-27-18-23(13-14-28(27)36)29(37)19-31-16-15-21-7-6-10-24(17-21)33-30(38)34-26-12-5-4-11-25(26)22-8-2-1-3-9-22/h1-14,17-18,20,29,31,36-37H,15-16,19H2,(H,32,35)(H2,33,34,38)/t29-/m1/s1 |
| InChIKey | CRENOMPMIHKRCK-GDLZYMKVSA-N |
| XLogP | 5.14 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|