C38H43N5O6 — CID 73091854
[1-[3-[4-[2-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 73091854) has the molecular formula C38H43N5O6 and a molecular weight of 665.79 g/mol. Its IUPAC name is [1-[3-[4-[2-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[3-[4-[2-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 73091854 |
| Molecular Formula | C38H43N5O6 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | [1-[3-[4-[2-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=CNc1cc(C(O)CNCCc2ccc(NC(=O)CCN3CCC(OC(=O)Nc4ccccc4-c4ccccc4)CC3)cc2)ccc1O |
| InChI | InChI=1S/C38H43N5O6/c44-26-40-34-24-29(12-15-35(34)45)36(46)25-39-20-16-27-10-13-30(14-11-27)41-37(47)19-23-43-21-17-31(18-22-43)49-38(48)42-33-9-5-4-8-32(33)28-6-2-1-3-7-28/h1-15,24,26,31,36,39,45-46H,16-23,25H2,(H,40,44)(H,41,47)(H,42,48) |
| InChIKey | MSPQQLHGSZGDCM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|