C36H49ClN4O7S — CID 24764458
[1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl] N-[2-(3-chloro-4-hydroxyphenyl)phenyl]carbamate (PubChem CID 24764458) has the molecular formula C36H49ClN4O7S and a molecular weight of 717.33 g/mol. Its IUPAC name is [1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl] N-[2-(3-chloro-4-hydroxyphenyl)phenyl]carbamate.
| Compound Name | [1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl] N-[2-(3-chloro-4-hydroxyphenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 24764458 |
| Molecular Formula | C36H49ClN4O7S |
| Molecular Weight | 717.33 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | [1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl] N-[2-(3-chloro-4-hydroxyphenyl)phenyl]carbamate |
| SMILES | CS(=O)(=O)Nc1cc([C@@H](O)CNCCCCCCCCCN2CCC(OC(=O)Nc3ccccc3-c3ccc(O)c(Cl)c3)CC2)ccc1O |
| InChI | InChI=1S/C36H49ClN4O7S/c1-49(46,47)40-32-24-27(14-16-34(32)43)35(44)25-38-19-9-5-3-2-4-6-10-20-41-21-17-28(18-22-41)48-36(45)39-31-12-8-7-11-29(31)26-13-15-33(42)30(37)23-26/h7-8,11-16,23-24,28,35,38,40,42-44H,2-6,9-10,17-22,25H2,1H3,(H,39,45)/t35-/m0/s1 |
| InChIKey | NLEWMFKEAMXROY-DHUJRADRSA-N |
| XLogP | 6.86 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.33 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|