C41H49N5O6 — CID 87086759
[1-[3-[2,5-diethyl-4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 87086759) has the molecular formula C41H49N5O6 and a molecular weight of 707.87 g/mol. Its IUPAC name is [1-[3-[2,5-diethyl-4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[3-[2,5-diethyl-4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 87086759 |
| Molecular Formula | C41H49N5O6 |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | [1-[3-[2,5-diethyl-4-[[[(2S)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]methyl]anilino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCc1cc(NC(=O)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)c(CC)cc1CNC[C@@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C41H49N5O6/c1-3-28-23-36(29(4-2)22-32(28)25-42-26-39(49)31-14-15-38(48)37(24-31)43-27-47)44-40(50)18-21-46-19-16-33(17-20-46)52-41(51)45-35-13-9-8-12-34(35)30-10-6-5-7-11-30/h5-15,22-24,27,33,39,42,48-49H,3-4,16-21,25-26H2,1-2H3,(H,43,47)(H,44,50)(H,45,51)/t39-/m1/s1 |
| InChIKey | KHWHYAGSWBXBEZ-LDLOPFEMSA-N |
| XLogP | 6.62 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|