C36H49ClN4O7S — CID 69269469
[2-chloro-6-(4-hydroxyphenyl)phenyl]-[1-[9-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl]carbamic acid (PubChem CID 69269469) has the molecular formula C36H49ClN4O7S and a molecular weight of 717.33 g/mol. Its IUPAC name is [2-chloro-6-(4-hydroxyphenyl)phenyl]-[1-[9-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl]carbamic acid.
| Compound Name | [2-chloro-6-(4-hydroxyphenyl)phenyl]-[1-[9-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69269469 |
| Molecular Formula | C36H49ClN4O7S |
| Molecular Weight | 717.33 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | [2-chloro-6-(4-hydroxyphenyl)phenyl]-[1-[9-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]nonyl]piperidin-4-yl]carbamic acid |
| SMILES | CS(=O)(=O)Nc1cc([C@H](O)CNCCCCCCCCCN2CCC(N(C(=O)O)c3c(Cl)cccc3-c3ccc(O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C36H49ClN4O7S/c1-49(47,48)39-32-24-27(14-17-33(32)43)34(44)25-38-20-7-5-3-2-4-6-8-21-40-22-18-28(19-23-40)41(36(45)46)35-30(10-9-11-31(35)37)26-12-15-29(42)16-13-26/h9-17,24,28,34,38-39,42-44H,2-8,18-23,25H2,1H3,(H,45,46)/t34-/m1/s1 |
| InChIKey | MKGLGDMTMLLBDQ-UUWRZZSWSA-N |
| XLogP | 6.79 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.33 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|