C17H25N3 — CID 66398289
N'-benzyl-N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]propane-1,3-diamine (PubChem CID 66398289) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N'-benzyl-N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 66398289 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N'-benzyl-N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]propane-1,3-diamine |
| SMILES | CN(CCCNCc1ccn(C)c1)Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3/c1-19(14-16-7-4-3-5-8-16)11-6-10-18-13-17-9-12-20(2)15-17/h3-5,7-9,12,15,18H,6,10-11,13-14H2,1-2H3 |
| InChIKey | VMVFQVLSRXHHBE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|