C8H13FN2 — CID 130478299
2-fluoro-N-[(1-methylpyrrol-3-yl)methyl]ethanamine (PubChem CID 130478299) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is 2-fluoro-N-[(1-methylpyrrol-3-yl)methyl]ethanamine.
| Compound Name | 2-fluoro-N-[(1-methylpyrrol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 130478299 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 2-fluoro-N-[(1-methylpyrrol-3-yl)methyl]ethanamine |
| SMILES | Cn1ccc(CNCCF)c1 |
| InChI | InChI=1S/C8H13FN2/c1-11-5-2-8(7-11)6-10-4-3-9/h2,5,7,10H,3-4,6H2,1H3 |
| InChIKey | MHLALSFHZVINAL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|