C9H14N2 — CID 66399137
N-[(1-methylpyrrol-3-yl)methyl]prop-2-en-1-amine (PubChem CID 66399137) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-[(1-methylpyrrol-3-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(1-methylpyrrol-3-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 66399137 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-[(1-methylpyrrol-3-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccn(C)c1 |
| InChI | InChI=1S/C9H14N2/c1-3-5-10-7-9-4-6-11(2)8-9/h3-4,6,8,10H,1,5,7H2,2H3 |
| InChIKey | AJYNWISURRTYPF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|