C10H14N2 — CID 66397506
N-[(1-methylpyrrol-3-yl)methyl]but-3-yn-1-amine (PubChem CID 66397506) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-[(1-methylpyrrol-3-yl)methyl]but-3-yn-1-amine.
| Compound Name | N-[(1-methylpyrrol-3-yl)methyl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 66397506 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-[(1-methylpyrrol-3-yl)methyl]but-3-yn-1-amine |
| SMILES | C#CCCNCc1ccn(C)c1 |
| InChI | InChI=1S/C10H14N2/c1-3-4-6-11-8-10-5-7-12(2)9-10/h1,5,7,9,11H,4,6,8H2,2H3 |
| InChIKey | OWXWWWTWEWGCSZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|