C10H18N2O — CID 66399627
2-methyl-3-[(1-methylpyrrol-3-yl)methylamino]propan-1-ol (PubChem CID 66399627) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methyl-3-[(1-methylpyrrol-3-yl)methylamino]propan-1-ol.
| Compound Name | 2-methyl-3-[(1-methylpyrrol-3-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 66399627 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-methyl-3-[(1-methylpyrrol-3-yl)methylamino]propan-1-ol |
| SMILES | CC(CO)CNCc1ccn(C)c1 |
| InChI | InChI=1S/C10H18N2O/c1-9(8-13)5-11-6-10-3-4-12(2)7-10/h3-4,7,9,11,13H,5-6,8H2,1-2H3 |
| InChIKey | DRNQJVNXKLDHHU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |