C13H24N2 — CID 66416750
2-methyl-N-[(1-propylpyrrol-3-yl)methyl]butan-1-amine (PubChem CID 66416750) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-methyl-N-[(1-propylpyrrol-3-yl)methyl]butan-1-amine.
| Compound Name | 2-methyl-N-[(1-propylpyrrol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 66416750 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2-methyl-N-[(1-propylpyrrol-3-yl)methyl]butan-1-amine |
| SMILES | CCCn1ccc(CNCC(C)CC)c1 |
| InChI | InChI=1S/C13H24N2/c1-4-7-15-8-6-13(11-15)10-14-9-12(3)5-2/h6,8,11-12,14H,4-5,7,9-10H2,1-3H3 |
| InChIKey | NVKSDSVFNKMBKN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |