C14H26N2 — CID 66406832
2-methyl-N-[[1-(2-methylbutyl)pyrrol-3-yl]methyl]propan-1-amine (PubChem CID 66406832) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-methyl-N-[[1-(2-methylbutyl)pyrrol-3-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[1-(2-methylbutyl)pyrrol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66406832 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-methyl-N-[[1-(2-methylbutyl)pyrrol-3-yl]methyl]propan-1-amine |
| SMILES | CCC(C)Cn1ccc(CNCC(C)C)c1 |
| InChI | InChI=1S/C14H26N2/c1-5-13(4)10-16-7-6-14(11-16)9-15-8-12(2)3/h6-7,11-13,15H,5,8-10H2,1-4H3 |
| InChIKey | CWVDKDFRMPZNSQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |