C17H30N2O2 — CID 66405802
ethyl 6-[3-[(2-methylpropylamino)methyl]pyrrol-1-yl]hexanoate (PubChem CID 66405802) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is ethyl 6-[3-[(2-methylpropylamino)methyl]pyrrol-1-yl]hexanoate.
| Compound Name | ethyl 6-[3-[(2-methylpropylamino)methyl]pyrrol-1-yl]hexanoate |
|---|---|
| PubChem CID | 66405802 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | ethyl 6-[3-[(2-methylpropylamino)methyl]pyrrol-1-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCn1ccc(CNCC(C)C)c1 |
| InChI | InChI=1S/C17H30N2O2/c1-4-21-17(20)8-6-5-7-10-19-11-9-16(14-19)13-18-12-15(2)3/h9,11,14-15,18H,4-8,10,12-13H2,1-3H3 |
| InChIKey | PVZVBUHTGMAZLK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|