C16H15N7 — CID 133309760
N'-(7H-purin-6-yl)-N-quinolin-2-ylethane-1,2-diamine (PubChem CID 133309760) has the molecular formula C16H15N7 and a molecular weight of 305.35 g/mol. Its IUPAC name is N'-(7H-purin-6-yl)-N-quinolin-2-ylethane-1,2-diamine.
| Compound Name | N'-(7H-purin-6-yl)-N-quinolin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 133309760 |
| Molecular Formula | C16H15N7 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N'-(7H-purin-6-yl)-N-quinolin-2-ylethane-1,2-diamine |
| SMILES | c1ccc2nc(NCCNc3ncnc4nc[nH]c34)ccc2c1 |
| InChI | InChI=1S/C16H15N7/c1-2-4-12-11(3-1)5-6-13(23-12)17-7-8-18-15-14-16(20-9-19-14)22-10-21-15/h1-6,9-10H,7-8H2,(H,17,23)(H2,18,19,20,21,22) |
| InChIKey | UVTAHQKXKVPQLU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|