C10H10N6S — CID 49432029
N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine (PubChem CID 49432029) has the molecular formula C10H10N6S and a molecular weight of 246.30 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 49432029 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine |
| SMILES | c1csc(CCNc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C10H10N6S/c1(7-11-3-4-17-7)2-12-9-8-10(14-5-13-8)16-6-15-9/h3-6H,1-2H2,(H2,12,13,14,15,16) |
| InChIKey | KECOSQVHWCAMLF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |