C9H9N7O — CID 114184557
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-7H-purin-6-amine (PubChem CID 114184557) has the molecular formula C9H9N7O and a molecular weight of 231.22 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 114184557 |
| Molecular Formula | C9H9N7O |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-7H-purin-6-amine |
| SMILES | c1nc(NCCc2ncon2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H9N7O/c1(6-15-5-17-16-6)2-10-8-7-9(12-3-11-7)14-4-13-8/h3-5H,1-2H2,(H2,10,11,12,13,14) |
| InChIKey | UIWJHVRGYMODLR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |