C13H14N6O2S — CID 519855
4-[2-(7H-purin-6-ylamino)ethyl]benzenesulfonamide (PubChem CID 519855) has the molecular formula C13H14N6O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-[2-(7H-purin-6-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(7H-purin-6-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 519855 |
| Molecular Formula | C13H14N6O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[2-(7H-purin-6-ylamino)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H14N6O2S/c14-22(20,21)10-3-1-9(2-4-10)5-6-15-12-11-13(17-7-16-11)19-8-18-12/h1-4,7-8H,5-6H2,(H2,14,20,21)(H2,15,16,17,18,19) |
| InChIKey | HNTKMTOFOQSLQA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |