C10H12N8 — CID 64530053
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-7H-purin-6-amine (PubChem CID 64530053) has the molecular formula C10H12N8 and a molecular weight of 244.26 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-7H-purin-6-amine.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 64530053 |
| Molecular Formula | C10H12N8 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-7H-purin-6-amine |
| SMILES | c1n[nH]c(CCCNc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C10H12N8/c1(2-7-12-6-17-18-7)3-11-9-8-10(14-4-13-8)16-5-15-9/h4-6H,1-3H2,(H,12,17,18)(H2,11,13,14,15,16) |
| InChIKey | YRPMLTQSPMBYFQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|